C14H10BrClF2O — CID 107477582
1-[bromo-(4-methoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene (PubChem CID 107477582) has the molecular formula C14H10BrClF2O and a molecular weight of 347.59 g/mol. Its IUPAC name is 1-[bromo-(4-methoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-[bromo-(4-methoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477582 |
| Molecular Formula | C14H10BrClF2O |
| Molecular Weight | 347.59 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 1-[bromo-(4-methoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene |
| SMILES | COc1ccc(C(Br)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10BrClF2O/c1-19-9-4-2-8(3-5-9)14(15)10-6-12(17)13(18)7-11(10)16/h2-7,14H,1H3 |
| InChIKey | IDYPPTRXKVZARZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.59 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|