C14H11BrCl2O — CID 63436956
2-[bromo-(4-methoxyphenyl)methyl]-1,4-dichlorobenzene (PubChem CID 63436956) has the molecular formula C14H11BrCl2O and a molecular weight of 346.05 g/mol. Its IUPAC name is 2-[bromo-(4-methoxyphenyl)methyl]-1,4-dichlorobenzene.
| Compound Name | 2-[bromo-(4-methoxyphenyl)methyl]-1,4-dichlorobenzene |
|---|---|
| PubChem CID | 63436956 |
| Molecular Formula | C14H11BrCl2O |
| Molecular Weight | 346.05 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 2-[bromo-(4-methoxyphenyl)methyl]-1,4-dichlorobenzene |
| SMILES | COc1ccc(C(Br)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C14H11BrCl2O/c1-18-11-5-2-9(3-6-11)14(15)12-8-10(16)4-7-13(12)17/h2-8,14H,1H3 |
| InChIKey | ZGTQEQIPWDISSO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|