C15H12BrClF2O2 — CID 107477523
1-[bromo-(2,6-dimethoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene (PubChem CID 107477523) has the molecular formula C15H12BrClF2O2 and a molecular weight of 377.61 g/mol. Its IUPAC name is 1-[bromo-(2,6-dimethoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-[bromo-(2,6-dimethoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477523 |
| Molecular Formula | C15H12BrClF2O2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 1-[bromo-(2,6-dimethoxyphenyl)methyl]-2-chloro-4,5-difluorobenzene |
| SMILES | COc1cccc(OC)c1C(Br)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C15H12BrClF2O2/c1-20-12-4-3-5-13(21-2)14(12)15(16)8-6-10(18)11(19)7-9(8)17/h3-7,15H,1-2H3 |
| InChIKey | NKOFMOFHQBVLGS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|