C15H13BrClFO2 — CID 63444828
1-[bromo-(2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxybenzene (PubChem CID 63444828) has the molecular formula C15H13BrClFO2 and a molecular weight of 359.62 g/mol. Its IUPAC name is 1-[bromo-(2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxybenzene.
| Compound Name | 1-[bromo-(2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63444828 |
| Molecular Formula | C15H13BrClFO2 |
| Molecular Weight | 359.62 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 1-[bromo-(2-fluorophenyl)methyl]-2-chloro-4,5-dimethoxybenzene |
| SMILES | COc1cc(Cl)c(C(Br)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C15H13BrClFO2/c1-19-13-7-10(11(17)8-14(13)20-2)15(16)9-5-3-4-6-12(9)18/h3-8,15H,1-2H3 |
| InChIKey | CXLZVBOFOUGDDM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|