C14H11BrF2O — CID 61096891
2-[bromo-(2-methoxyphenyl)methyl]-1,4-difluorobenzene (PubChem CID 61096891) has the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. Its IUPAC name is 2-[bromo-(2-methoxyphenyl)methyl]-1,4-difluorobenzene.
| Compound Name | 2-[bromo-(2-methoxyphenyl)methyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 61096891 |
| Molecular Formula | C14H11BrF2O |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-[bromo-(2-methoxyphenyl)methyl]-1,4-difluorobenzene |
| SMILES | COc1ccccc1C(Br)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H11BrF2O/c1-18-13-5-3-2-4-10(13)14(15)11-8-9(16)6-7-12(11)17/h2-8,14H,1H3 |
| InChIKey | XGNYTPMSFNMRSR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|