C12H8Br3FOS — CID 107964679
2,5-dibromo-3-[bromo-(5-fluoro-2-methoxyphenyl)methyl]thiophene (PubChem CID 107964679) has the molecular formula C12H8Br3FOS and a molecular weight of 458.97 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo-(5-fluoro-2-methoxyphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo-(5-fluoro-2-methoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 107964679 |
| Molecular Formula | C12H8Br3FOS |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 455.78 |
| IUPAC Name | 2,5-dibromo-3-[bromo-(5-fluoro-2-methoxyphenyl)methyl]thiophene |
| SMILES | COc1ccc(F)cc1C(Br)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H8Br3FOS/c1-17-9-3-2-6(16)4-7(9)11(14)8-5-10(13)18-12(8)15/h2-5,11H,1H3 |
| InChIKey | LZVOKWLUIAHQHE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|