C13H10Br4O2S — CID 107964666
2,5-dibromo-3-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]thiophene (PubChem CID 107964666) has the molecular formula C13H10Br4O2S and a molecular weight of 549.90 g/mol. Its IUPAC name is 2,5-dibromo-3-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]thiophene.
| Compound Name | 2,5-dibromo-3-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 107964666 |
| Molecular Formula | C13H10Br4O2S |
| Molecular Weight | 549.90 g/mol |
| Exact Mass | 545.71 |
| IUPAC Name | 2,5-dibromo-3-[bromo-(2-bromo-4,5-dimethoxyphenyl)methyl]thiophene |
| SMILES | COc1cc(Br)c(C(Br)c2cc(Br)sc2Br)cc1OC |
| InChI | InChI=1S/C13H10Br4O2S/c1-18-9-3-6(8(14)5-10(9)19-2)12(16)7-4-11(15)20-13(7)17/h3-5,12H,1-2H3 |
| InChIKey | DYZFDPNEPDUMKT-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.90 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|