C10H12Br2O2 — CID 61096538
1-bromo-2-(1-bromoethyl)-4,5-dimethoxybenzene (PubChem CID 61096538) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is 1-bromo-2-(1-bromoethyl)-4,5-dimethoxybenzene.
| Compound Name | 1-bromo-2-(1-bromoethyl)-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 61096538 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | 1-bromo-2-(1-bromoethyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(C(C)Br)cc1OC |
| InChI | InChI=1S/C10H12Br2O2/c1-6(11)7-4-9(13-2)10(14-3)5-8(7)12/h4-6H,1-3H3 |
| InChIKey | PDSWRHOWPBHUMW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|