C16H24Br2O2 — CID 63832973
1-bromo-2-(1-bromo-3,4,4-trimethylpentyl)-4,5-dimethoxybenzene (PubChem CID 63832973) has the molecular formula C16H24Br2O2 and a molecular weight of 408.17 g/mol. Its IUPAC name is 1-bromo-2-(1-bromo-3,4,4-trimethylpentyl)-4,5-dimethoxybenzene.
| Compound Name | 1-bromo-2-(1-bromo-3,4,4-trimethylpentyl)-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63832973 |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 1-bromo-2-(1-bromo-3,4,4-trimethylpentyl)-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(C(Br)CC(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C16H24Br2O2/c1-10(16(2,3)4)7-12(17)11-8-14(19-5)15(20-6)9-13(11)18/h8-10,12H,7H2,1-6H3 |
| InChIKey | NQSHNGUGXXHMBV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|