C15H21BrClFO — CID 103396310
1-bromo-5-(1-chloro-3,4,4-trimethylpentyl)-2-fluoro-4-methoxybenzene (PubChem CID 103396310) has the molecular formula C15H21BrClFO and a molecular weight of 351.69 g/mol. Its IUPAC name is 1-bromo-5-(1-chloro-3,4,4-trimethylpentyl)-2-fluoro-4-methoxybenzene.
| Compound Name | 1-bromo-5-(1-chloro-3,4,4-trimethylpentyl)-2-fluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 103396310 |
| Molecular Formula | C15H21BrClFO |
| Molecular Weight | 351.69 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-bromo-5-(1-chloro-3,4,4-trimethylpentyl)-2-fluoro-4-methoxybenzene |
| SMILES | COc1cc(F)c(Br)cc1C(Cl)CC(C)C(C)(C)C |
| InChI | InChI=1S/C15H21BrClFO/c1-9(15(2,3)4)6-12(17)10-7-11(16)13(18)8-14(10)19-5/h7-9,12H,6H2,1-5H3 |
| InChIKey | WSYTUVIQLRBMPB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|