C16H24Br2O — CID 65434345
1-bromo-5-(1-bromo-3,4,4-trimethylpentyl)-4-methoxy-2-methylbenzene (PubChem CID 65434345) has the molecular formula C16H24Br2O and a molecular weight of 392.18 g/mol. Its IUPAC name is 1-bromo-5-(1-bromo-3,4,4-trimethylpentyl)-4-methoxy-2-methylbenzene.
| Compound Name | 1-bromo-5-(1-bromo-3,4,4-trimethylpentyl)-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 65434345 |
| Molecular Formula | C16H24Br2O |
| Molecular Weight | 392.18 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 1-bromo-5-(1-bromo-3,4,4-trimethylpentyl)-4-methoxy-2-methylbenzene |
| SMILES | COc1cc(C)c(Br)cc1C(Br)CC(C)C(C)(C)C |
| InChI | InChI=1S/C16H24Br2O/c1-10-7-15(19-6)12(9-13(10)17)14(18)8-11(2)16(3,4)5/h7,9,11,14H,8H2,1-6H3 |
| InChIKey | RIQLESJBUWQJQJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.18 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|