C11H11BrF5NO — CID 65439545
1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine (PubChem CID 65439545) has the molecular formula C11H11BrF5NO and a molecular weight of 348.11 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine.
| Compound Name | 1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
|---|---|
| PubChem CID | 65439545 |
| Molecular Formula | C11H11BrF5NO |
| Molecular Weight | 348.11 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 1-(5-bromo-2-methoxy-4-methylphenyl)-2,2,3,3,3-pentafluoropropan-1-amine |
| SMILES | COc1cc(C)c(Br)cc1C(N)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11BrF5NO/c1-5-3-8(19-2)6(4-7(5)12)9(18)10(13,14)11(15,16)17/h3-4,9H,18H2,1-2H3 |
| InChIKey | WVOWWRKVZWVLJT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.11 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|