C11H11F6NO2 — CID 62867617
2,2,3,3,3-pentafluoro-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-amine (PubChem CID 62867617) has the molecular formula C11H11F6NO2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-amine.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 62867617 |
| Molecular Formula | C11H11F6NO2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(2-fluoro-4,5-dimethoxyphenyl)propan-1-amine |
| SMILES | COc1cc(F)c(C(N)C(F)(F)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H11F6NO2/c1-19-7-3-5(6(12)4-8(7)20-2)9(18)10(13,14)11(15,16)17/h3-4,9H,18H2,1-2H3 |
| InChIKey | FKCRWYZDTLRUAR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|