C11H12BrClF5NO2 — CID 171311975
(1S)-1-(4-bromo-2,5-dimethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171311975) has the molecular formula C11H12BrClF5NO2 and a molecular weight of 400.57 g/mol. Its IUPAC name is (1S)-1-(4-bromo-2,5-dimethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4-bromo-2,5-dimethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311975 |
| Molecular Formula | C11H12BrClF5NO2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | (1S)-1-(4-bromo-2,5-dimethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | COc1cc([C@H](N)C(F)(F)C(F)(F)F)c(OC)cc1Br.Cl |
| InChI | InChI=1S/C11H11BrF5NO2.ClH/c1-19-7-4-6(12)8(20-2)3-5(7)9(18)10(13,14)11(15,16)17;/h3-4,9H,18H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | LULAEFODBFGLJT-FVGYRXGTSA-N |
| XLogP | 4.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|