C18H19ClF5NO3 — CID 171312678
(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171312678) has the molecular formula C18H19ClF5NO3 and a molecular weight of 427.80 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171312678 |
| Molecular Formula | C18H19ClF5NO3 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | COc1cc(OCc2ccccc2)c([C@@H](N)C(F)(F)C(F)(F)F)cc1OC.Cl |
| InChI | InChI=1S/C18H18F5NO3.ClH/c1-25-14-8-12(16(24)17(19,20)18(21,22)23)13(9-15(14)26-2)27-10-11-6-4-3-5-7-11;/h3-9,16H,10,24H2,1-2H3;1H/t16-;/m1./s1 |
| InChIKey | YTEZUWJAVKWUAK-PKLMIRHRSA-N |
| XLogP | 4.90 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|