C17H22N2O3 — CID 171214318
(1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine (PubChem CID 171214318) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 171214318 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (1S)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(OCc2ccccc2)c([C@H](N)CN)cc1OC |
| InChI | InChI=1S/C17H22N2O3/c1-20-16-8-13(14(19)10-18)15(9-17(16)21-2)22-11-12-6-4-3-5-7-12/h3-9,14H,10-11,18-19H2,1-2H3/t14-/m1/s1 |
| InChIKey | QEWZKBMGXBZJFJ-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |