C18H20N2O3 — CID 171260650
(3R)-3-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propanenitrile (PubChem CID 171260650) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3R)-3-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propanenitrile.
| Compound Name | (3R)-3-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 171260650 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3R)-3-amino-3-(4,5-dimethoxy-2-phenylmethoxyphenyl)propanenitrile |
| SMILES | COc1cc(OCc2ccccc2)c([C@H](N)CC#N)cc1OC |
| InChI | InChI=1S/C18H20N2O3/c1-21-17-10-14(15(20)8-9-19)16(11-18(17)22-2)23-12-13-6-4-3-5-7-13/h3-7,10-11,15H,8,12,20H2,1-2H3/t15-/m1/s1 |
| InChIKey | LSPROXCARDNLDZ-OAHLLOKOSA-N |
| XLogP | 3.20 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |