C19H24O3 — CID 10804189
1-butan-2-yl-4,5-dimethoxy-2-phenylmethoxybenzene (PubChem CID 10804189) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-butan-2-yl-4,5-dimethoxy-2-phenylmethoxybenzene.
| Compound Name | 1-butan-2-yl-4,5-dimethoxy-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 10804189 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-butan-2-yl-4,5-dimethoxy-2-phenylmethoxybenzene |
| SMILES | CCC(C)c1cc(OC)c(OC)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H24O3/c1-5-14(2)16-11-18(20-3)19(21-4)12-17(16)22-13-15-9-7-6-8-10-15/h6-12,14H,5,13H2,1-4H3 |
| InChIKey | HZSVRAKFMVITFT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |