C20H26O4 — CID 130368760
1-ethoxy-4,5-dimethoxy-2-(1-phenylmethoxypropan-2-yl)benzene (PubChem CID 130368760) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-ethoxy-4,5-dimethoxy-2-(1-phenylmethoxypropan-2-yl)benzene.
| Compound Name | 1-ethoxy-4,5-dimethoxy-2-(1-phenylmethoxypropan-2-yl)benzene |
|---|---|
| PubChem CID | 130368760 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-ethoxy-4,5-dimethoxy-2-(1-phenylmethoxypropan-2-yl)benzene |
| SMILES | CCOc1cc(OC)c(OC)cc1C(C)COCc1ccccc1 |
| InChI | InChI=1S/C20H26O4/c1-5-24-18-12-20(22-4)19(21-3)11-17(18)15(2)13-23-14-16-9-7-6-8-10-16/h6-12,15H,5,13-14H2,1-4H3 |
| InChIKey | PFHBVPUUBYJRSZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |