C18H23NO4 — CID 171265334
(1R,2S)-1-amino-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-2-ol (PubChem CID 171265334) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 171265334 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (1R,2S)-1-amino-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)propan-2-ol |
| SMILES | COc1cc(OCc2ccccc2)c([C@@H](N)[C@H](C)O)cc1OC |
| InChI | InChI=1S/C18H23NO4/c1-12(20)18(19)14-9-16(21-2)17(22-3)10-15(14)23-11-13-7-5-4-6-8-13/h4-10,12,18,20H,11,19H2,1-3H3/t12-,18-/m0/s1 |
| InChIKey | KVDYPYNHWARHLN-SGTLLEGYSA-N |
| XLogP | 2.66 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |