C21H27NO4 — CID 171271013
(1R,2S)-2-amino-1-cyclobutyl-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanol (PubChem CID 171271013) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclobutyl-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclobutyl-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 171271013 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclobutyl-2-(4,5-dimethoxy-2-phenylmethoxyphenyl)ethanol |
| SMILES | COc1cc(OCc2ccccc2)c([C@H](N)[C@H](O)C2CCC2)cc1OC |
| InChI | InChI=1S/C21H27NO4/c1-24-18-11-16(20(22)21(23)15-9-6-10-15)17(12-19(18)25-2)26-13-14-7-4-3-5-8-14/h3-5,7-8,11-12,15,20-21,23H,6,9-10,13,22H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | PGHBCGLASKPSGF-LEWJYISDSA-N |
| XLogP | 3.44 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |