C19H26ClNO3 — CID 171214333
(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butan-1-amine;hydrochloride (PubChem CID 171214333) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171214333 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)butan-1-amine;hydrochloride |
| SMILES | CCC[C@@H](N)c1cc(OC)c(OC)cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C19H25NO3.ClH/c1-4-8-16(20)15-11-18(21-2)19(22-3)12-17(15)23-13-14-9-6-5-7-10-14;/h5-7,9-12,16H,4,8,13,20H2,1-3H3;1H/t16-;/m1./s1 |
| InChIKey | VWHHKOKOICGTAW-PKLMIRHRSA-N |
| XLogP | 4.50 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |