C21H29NO3 — CID 171214368
(1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4-methylpentan-1-amine (PubChem CID 171214368) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4-methylpentan-1-amine.
| Compound Name | (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 171214368 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (1R)-1-(4,5-dimethoxy-2-phenylmethoxyphenyl)-4-methylpentan-1-amine |
| SMILES | COc1cc(OCc2ccccc2)c([C@H](N)CCC(C)C)cc1OC |
| InChI | InChI=1S/C21H29NO3/c1-15(2)10-11-18(22)17-12-20(23-3)21(24-4)13-19(17)25-14-16-8-6-5-7-9-16/h5-9,12-13,15,18H,10-11,14,22H2,1-4H3/t18-/m1/s1 |
| InChIKey | UMAKBZDXRUIMTR-GOSISDBHSA-N |
| XLogP | 4.72 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |