C20H28NO6P — CID 171191970
(S)-diethoxyphosphoryl-(4,5-dimethoxy-2-phenylmethoxyphenyl)methanamine (PubChem CID 171191970) has the molecular formula C20H28NO6P and a molecular weight of 409.42 g/mol. Its IUPAC name is (S)-diethoxyphosphoryl-(4,5-dimethoxy-2-phenylmethoxyphenyl)methanamine.
| Compound Name | (S)-diethoxyphosphoryl-(4,5-dimethoxy-2-phenylmethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 171191970 |
| Molecular Formula | C20H28NO6P |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (S)-diethoxyphosphoryl-(4,5-dimethoxy-2-phenylmethoxyphenyl)methanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cc(OC)c(OC)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H28NO6P/c1-5-26-28(22,27-6-2)20(21)16-12-18(23-3)19(24-4)13-17(16)25-14-15-10-8-7-9-11-15/h7-13,20H,5-6,14,21H2,1-4H3/t20-/m0/s1 |
| InChIKey | LOSWACHDEFRNOJ-FQEVSTJZSA-N |
| XLogP | 4.51 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|