C18H24NO4P — CID 171191904
(S)-diethoxyphosphoryl-(3-phenylmethoxyphenyl)methanamine (PubChem CID 171191904) has the molecular formula C18H24NO4P and a molecular weight of 349.37 g/mol. Its IUPAC name is (S)-diethoxyphosphoryl-(3-phenylmethoxyphenyl)methanamine.
| Compound Name | (S)-diethoxyphosphoryl-(3-phenylmethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 171191904 |
| Molecular Formula | C18H24NO4P |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (S)-diethoxyphosphoryl-(3-phenylmethoxyphenyl)methanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H24NO4P/c1-3-22-24(20,23-4-2)18(19)16-11-8-12-17(13-16)21-14-15-9-6-5-7-10-15/h5-13,18H,3-4,14,19H2,1-2H3/t18-/m0/s1 |
| InChIKey | UGKMLKRUAKFYBU-SFHVURJKSA-N |
| XLogP | 4.49 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|