C12H17F3NO4P — CID 171191880
(S)-diethoxyphosphoryl-[3-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171191880) has the molecular formula C12H17F3NO4P and a molecular weight of 327.24 g/mol. Its IUPAC name is (S)-diethoxyphosphoryl-[3-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (S)-diethoxyphosphoryl-[3-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171191880 |
| Molecular Formula | C12H17F3NO4P |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (S)-diethoxyphosphoryl-[3-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3NO4P/c1-3-18-21(17,19-4-2)11(16)9-6-5-7-10(8-9)20-12(13,14)15/h5-8,11H,3-4,16H2,1-2H3/t11-/m0/s1 |
| InChIKey | DQHABDZPKYGWCO-NSHDSACASA-N |
| XLogP | 3.81 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|