C12H16F4NO4P — CID 171192259
(R)-diethoxyphosphoryl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171192259) has the molecular formula C12H16F4NO4P and a molecular weight of 345.23 g/mol. Its IUPAC name is (R)-diethoxyphosphoryl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (R)-diethoxyphosphoryl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171192259 |
| Molecular Formula | C12H16F4NO4P |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (R)-diethoxyphosphoryl-[3-fluoro-4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H16F4NO4P/c1-3-19-22(18,20-4-2)11(17)8-5-6-10(9(13)7-8)21-12(14,15)16/h5-7,11H,3-4,17H2,1-2H3/t11-/m1/s1 |
| InChIKey | IEHDCQRMBKEOIS-LLVKDONJSA-N |
| XLogP | 3.95 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|