C12H15F4NO2 — CID 171263562
(1R,2S)-1-amino-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentan-2-ol (PubChem CID 171263562) has the molecular formula C12H15F4NO2 and a molecular weight of 281.25 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 171263562 |
| Molecular Formula | C12H15F4NO2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (1R,2S)-1-amino-1-[3-fluoro-4-(trifluoromethoxy)phenyl]pentan-2-ol |
| SMILES | CCC[C@H](O)[C@H](N)c1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C12H15F4NO2/c1-2-3-9(18)11(17)7-4-5-10(8(13)6-7)19-12(14,15)16/h4-6,9,11,18H,2-3,17H2,1H3/t9-,11+/m0/s1 |
| InChIKey | PHMZZAYBCCENAO-GXSJLCMTSA-N |
| XLogP | 2.89 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |