C12H18FNO2 — CID 171159915
(1R,2S)-1-amino-1-(4-fluoro-3-methoxyphenyl)pentan-2-ol (PubChem CID 171159915) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-fluoro-3-methoxyphenyl)pentan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(4-fluoro-3-methoxyphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 171159915 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-fluoro-3-methoxyphenyl)pentan-2-ol |
| SMILES | CCC[C@H](O)[C@H](N)c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C12H18FNO2/c1-3-4-10(15)12(14)8-5-6-9(13)11(7-8)16-2/h5-7,10,12,15H,3-4,14H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | OMTAVCBZEKECDD-CMPLNLGQSA-N |
| XLogP | 2.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |