C11H17ClNO3P — CID 2313111
(R)-(4-chlorophenyl)-diethoxyphosphorylmethanamine (PubChem CID 2313111) has the molecular formula C11H17ClNO3P and a molecular weight of 277.69 g/mol. Its IUPAC name is (R)-(4-chlorophenyl)-diethoxyphosphorylmethanamine.
| Compound Name | (R)-(4-chlorophenyl)-diethoxyphosphorylmethanamine |
|---|---|
| PubChem CID | 2313111 |
| Molecular Formula | C11H17ClNO3P |
| Molecular Weight | 277.69 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | (R)-(4-chlorophenyl)-diethoxyphosphorylmethanamine |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H17ClNO3P/c1-3-15-17(14,16-4-2)11(13)9-5-7-10(12)8-6-9/h5-8,11H,3-4,13H2,1-2H3/t11-/m1/s1 |
| InChIKey | CLTNPSYRMWSMNP-LLVKDONJSA-N |
| XLogP | 3.56 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|