C11H17ClO6P2 — CID 102300014
[(4-chlorophenyl)-[ethoxy(hydroxy)phosphoryl]methyl]-ethoxyphosphinic acid (PubChem CID 102300014) has the molecular formula C11H17ClO6P2 and a molecular weight of 342.65 g/mol. Its IUPAC name is [(4-chlorophenyl)-[ethoxy(hydroxy)phosphoryl]methyl]-ethoxyphosphinic acid.
| Compound Name | [(4-chlorophenyl)-[ethoxy(hydroxy)phosphoryl]methyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 102300014 |
| Molecular Formula | C11H17ClO6P2 |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | [(4-chlorophenyl)-[ethoxy(hydroxy)phosphoryl]methyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)C(c1ccc(Cl)cc1)P(=O)(O)OCC |
| InChI | InChI=1S/C11H17ClO6P2/c1-3-17-19(13,14)11(20(15,16)18-4-2)9-5-7-10(12)8-6-9/h5-8,11H,3-4H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | LXTSLEZGUJLFGB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|