C8H11ClNO3P — CID 10513936
[2-amino-1-(4-chlorophenyl)ethyl]phosphonic acid (PubChem CID 10513936) has the molecular formula C8H11ClNO3P and a molecular weight of 235.61 g/mol. Its IUPAC name is [2-amino-1-(4-chlorophenyl)ethyl]phosphonic acid.
| Compound Name | [2-amino-1-(4-chlorophenyl)ethyl]phosphonic acid |
|---|---|
| PubChem CID | 10513936 |
| Molecular Formula | C8H11ClNO3P |
| Molecular Weight | 235.61 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | [2-amino-1-(4-chlorophenyl)ethyl]phosphonic acid |
| SMILES | NCC(c1ccc(Cl)cc1)P(=O)(O)O |
| InChI | InChI=1S/C8H11ClNO3P/c9-7-3-1-6(2-4-7)8(5-10)14(11,12)13/h1-4,8H,5,10H2,(H2,11,12,13) |
| InChIKey | HSVYZWJZUFUXDB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.61 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|