C14H23ClNO4P — CID 23928163
[(2R)-3-amino-2-(4-chlorophenyl)propyl]-(diethoxymethyl)phosphinic acid (PubChem CID 23928163) has the molecular formula C14H23ClNO4P and a molecular weight of 335.77 g/mol. Its IUPAC name is [(2R)-3-amino-2-(4-chlorophenyl)propyl]-(diethoxymethyl)phosphinic acid.
| Compound Name | [(2R)-3-amino-2-(4-chlorophenyl)propyl]-(diethoxymethyl)phosphinic acid |
|---|---|
| PubChem CID | 23928163 |
| Molecular Formula | C14H23ClNO4P |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [(2R)-3-amino-2-(4-chlorophenyl)propyl]-(diethoxymethyl)phosphinic acid |
| SMILES | CCOC(OCC)P(=O)(O)C[C@@H](CN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H23ClNO4P/c1-3-19-14(20-4-2)21(17,18)10-12(9-16)11-5-7-13(15)8-6-11/h5-8,12,14H,3-4,9-10,16H2,1-2H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | RUXNGYAPBMVEBP-GFCCVEGCSA-N |
| XLogP | 3.01 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|