C10H15ClN2 — CID 82076304
2-(4-chlorophenyl)butane-1,4-diamine (PubChem CID 82076304) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)butane-1,4-diamine.
| Compound Name | 2-(4-chlorophenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 82076304 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-(4-chlorophenyl)butane-1,4-diamine |
| SMILES | NCCC(CN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H15ClN2/c11-10-3-1-8(2-4-10)9(7-13)5-6-12/h1-4,9H,5-7,12-13H2 |
| InChIKey | YALRNODJDLYNIN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |