C12H15ClF3NO — CID 79442186
2-(4-chlorophenyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine (PubChem CID 79442186) has the molecular formula C12H15ClF3NO and a molecular weight of 281.71 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine.
| Compound Name | 2-(4-chlorophenyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine |
|---|---|
| PubChem CID | 79442186 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.71 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(2,2,2-trifluoroethoxy)butan-1-amine |
| SMILES | NCC(CCOCC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClF3NO/c13-11-3-1-9(2-4-11)10(7-17)5-6-18-8-12(14,15)16/h1-4,10H,5-8,17H2 |
| InChIKey | ATWCHGQTCMIMIF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.71 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|