C13H17ClF3NO — CID 62601816
1-(4-chlorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-2-amine (PubChem CID 62601816) has the molecular formula C13H17ClF3NO and a molecular weight of 295.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-2-amine.
| Compound Name | 1-(4-chlorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-2-amine |
|---|---|
| PubChem CID | 62601816 |
| Molecular Formula | C13H17ClF3NO |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-2-amine |
| SMILES | NC(CCCOCC(F)(F)F)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClF3NO/c14-11-5-3-10(4-6-11)8-12(18)2-1-7-19-9-13(15,16)17/h3-6,12H,1-2,7-9,18H2 |
| InChIKey | JKXIONRCFNASBX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|