C10H9Cl2F3O — CID 103210534
1-chloro-4-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]benzene (PubChem CID 103210534) has the molecular formula C10H9Cl2F3O and a molecular weight of 273.08 g/mol. Its IUPAC name is 1-chloro-4-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]benzene.
| Compound Name | 1-chloro-4-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]benzene |
|---|---|
| PubChem CID | 103210534 |
| Molecular Formula | C10H9Cl2F3O |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 1-chloro-4-[1-chloro-2-(2,2,2-trifluoroethoxy)ethyl]benzene |
| SMILES | FC(F)(F)COCC(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9Cl2F3O/c11-8-3-1-7(2-4-8)9(12)5-16-6-10(13,14)15/h1-4,9H,5-6H2 |
| InChIKey | WNPCOVBUOZUTDI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|