C9H7ClF3I — CID 102144336
1-chloro-4-(3,3,3-trifluoro-1-iodopropyl)benzene (PubChem CID 102144336) has the molecular formula C9H7ClF3I and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-chloro-4-(3,3,3-trifluoro-1-iodopropyl)benzene.
| Compound Name | 1-chloro-4-(3,3,3-trifluoro-1-iodopropyl)benzene |
|---|---|
| PubChem CID | 102144336 |
| Molecular Formula | C9H7ClF3I |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | 1-chloro-4-(3,3,3-trifluoro-1-iodopropyl)benzene |
| SMILES | FC(F)(F)CC(I)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H7ClF3I/c10-7-3-1-6(2-4-7)8(14)5-9(11,12)13/h1-4,8H,5H2 |
| InChIKey | AJZDBXMQTKQODZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|