C9H7ClF4O — CID 54771882
1-(4-chlorophenyl)-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 54771882) has the molecular formula C9H7ClF4O and a molecular weight of 242.60 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 54771882 |
| Molecular Formula | C9H7ClF4O |
| Molecular Weight | 242.60 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | OC(c1ccc(Cl)cc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H7ClF4O/c10-6-3-1-5(2-4-6)7(15)9(13,14)8(11)12/h1-4,7-8,15H |
| InChIKey | JDGIBSUEXQYJBP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|