C9H5ClF6O — CID 107477207
1-(2-chloro-4,5-difluorophenyl)-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 107477207) has the molecular formula C9H5ClF6O and a molecular weight of 278.58 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 107477207 |
| Molecular Formula | C9H5ClF6O |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | OC(c1cc(F)c(F)cc1Cl)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H5ClF6O/c10-4-2-6(12)5(11)1-3(4)7(17)9(15,16)8(13)14/h1-2,7-8,17H |
| InChIKey | MXKDFUIPPYFRKK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|