C11H11ClF4O2 — CID 107477047
1-(2-chloro-4,5-difluorophenyl)-3-(2,2-difluoroethoxy)propan-1-ol (PubChem CID 107477047) has the molecular formula C11H11ClF4O2 and a molecular weight of 286.65 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)-3-(2,2-difluoroethoxy)propan-1-ol.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)-3-(2,2-difluoroethoxy)propan-1-ol |
|---|---|
| PubChem CID | 107477047 |
| Molecular Formula | C11H11ClF4O2 |
| Molecular Weight | 286.65 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)-3-(2,2-difluoroethoxy)propan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H11ClF4O2/c12-7-4-9(14)8(13)3-6(7)10(17)1-2-18-5-11(15)16/h3-4,10-11,17H,1-2,5H2 |
| InChIKey | PWTGTOAJPDEBSY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|