C11H13F3O2 — CID 103147844
3-(2,2-difluoroethoxy)-1-(3-fluorophenyl)propan-1-ol (PubChem CID 103147844) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3-fluorophenyl)propan-1-ol.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3-fluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 103147844 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3-fluorophenyl)propan-1-ol |
| SMILES | OC(CCOCC(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C11H13F3O2/c12-9-3-1-2-8(6-9)10(15)4-5-16-7-11(13)14/h1-3,6,10-11,15H,4-5,7H2 |
| InChIKey | OCCVIHBKDVSPLD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|