C12H17FO2 — CID 105078293
1-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]ethanol (PubChem CID 105078293) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]ethanol.
| Compound Name | 1-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 105078293 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(3-fluorophenyl)-2-[(2-methylpropan-2-yl)oxy]ethanol |
| SMILES | CC(C)(C)OCC(O)c1cccc(F)c1 |
| InChI | InChI=1S/C12H17FO2/c1-12(2,3)15-8-11(14)9-5-4-6-10(13)7-9/h4-7,11,14H,8H2,1-3H3 |
| InChIKey | YMFGQEIHDUSZRE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |