C14H21FO2 — CID 112592372
2-(3-fluorophenyl)-4-[(2-methylpropan-2-yl)oxy]butan-1-ol (PubChem CID 112592372) has the molecular formula C14H21FO2 and a molecular weight of 240.32 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4-[(2-methylpropan-2-yl)oxy]butan-1-ol.
| Compound Name | 2-(3-fluorophenyl)-4-[(2-methylpropan-2-yl)oxy]butan-1-ol |
|---|---|
| PubChem CID | 112592372 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(3-fluorophenyl)-4-[(2-methylpropan-2-yl)oxy]butan-1-ol |
| SMILES | CC(C)(C)OCCC(CO)c1cccc(F)c1 |
| InChI | InChI=1S/C14H21FO2/c1-14(2,3)17-8-7-12(10-16)11-5-4-6-13(15)9-11/h4-6,9,12,16H,7-8,10H2,1-3H3 |
| InChIKey | ZKVPZUGETIPJOX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |