C14H15FOS — CID 79443461
2-(3-fluorophenyl)-4-thiophen-3-ylbutan-1-ol (PubChem CID 79443461) has the molecular formula C14H15FOS and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4-thiophen-3-ylbutan-1-ol.
| Compound Name | 2-(3-fluorophenyl)-4-thiophen-3-ylbutan-1-ol |
|---|---|
| PubChem CID | 79443461 |
| Molecular Formula | C14H15FOS |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-(3-fluorophenyl)-4-thiophen-3-ylbutan-1-ol |
| SMILES | OCC(CCc1ccsc1)c1cccc(F)c1 |
| InChI | InChI=1S/C14H15FOS/c15-14-3-1-2-12(8-14)13(9-16)5-4-11-6-7-17-10-11/h1-3,6-8,10,13,16H,4-5,9H2 |
| InChIKey | WQPQQCUNGAEMKA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |