C13H16F4O2 — CID 79443233
2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-1-ol (PubChem CID 79443233) has the molecular formula C13H16F4O2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-1-ol.
| Compound Name | 2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 79443233 |
| Molecular Formula | C13H16F4O2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentan-1-ol |
| SMILES | OCC(CCCOCC(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C13H16F4O2/c14-12-5-1-3-10(7-12)11(8-18)4-2-6-19-9-13(15,16)17/h1,3,5,7,11,18H,2,4,6,8-9H2 |
| InChIKey | CGNASOSVVZWPAS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|