C12H13BrF4O — CID 79433971
1-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]-3-fluorobenzene (PubChem CID 79433971) has the molecular formula C12H13BrF4O and a molecular weight of 329.13 g/mol. Its IUPAC name is 1-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]-3-fluorobenzene.
| Compound Name | 1-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]-3-fluorobenzene |
|---|---|
| PubChem CID | 79433971 |
| Molecular Formula | C12H13BrF4O |
| Molecular Weight | 329.13 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 1-[1-bromo-4-(2,2,2-trifluoroethoxy)butan-2-yl]-3-fluorobenzene |
| SMILES | Fc1cccc(C(CBr)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H13BrF4O/c13-7-10(4-5-18-8-12(15,16)17)9-2-1-3-11(14)6-9/h1-3,6,10H,4-5,7-8H2 |
| InChIKey | KKNPTLSASQYIQO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|