C13H14F4O3 — CID 79440635
2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 79440635) has the molecular formula C13H14F4O3 and a molecular weight of 294.24 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid.
| Compound Name | 2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
|---|---|
| PubChem CID | 79440635 |
| Molecular Formula | C13H14F4O3 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(3-fluorophenyl)-5-(2,2,2-trifluoroethoxy)pentanoic acid |
| SMILES | O=C(O)C(CCCOCC(F)(F)F)c1cccc(F)c1 |
| InChI | InChI=1S/C13H14F4O3/c14-10-4-1-3-9(7-10)11(12(18)19)5-2-6-20-8-13(15,16)17/h1,3-4,7,11H,2,5-6,8H2,(H,18,19) |
| InChIKey | BLRJJWKUXJFRCY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|