C14H18F4O2 — CID 66058858
2-[(3-fluorophenyl)methyl]-5-(2,2,2-trifluoroethoxy)pentan-1-ol (PubChem CID 66058858) has the molecular formula C14H18F4O2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-5-(2,2,2-trifluoroethoxy)pentan-1-ol.
| Compound Name | 2-[(3-fluorophenyl)methyl]-5-(2,2,2-trifluoroethoxy)pentan-1-ol |
|---|---|
| PubChem CID | 66058858 |
| Molecular Formula | C14H18F4O2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-5-(2,2,2-trifluoroethoxy)pentan-1-ol |
| SMILES | OCC(CCCOCC(F)(F)F)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H18F4O2/c15-13-5-1-3-11(8-13)7-12(9-19)4-2-6-20-10-14(16,17)18/h1,3,5,8,12,19H,2,4,6-7,9-10H2 |
| InChIKey | JGAJWYBDGNMYBX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|