C14H17BrClF3O — CID 66043122
1-[2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentyl]-3-chlorobenzene (PubChem CID 66043122) has the molecular formula C14H17BrClF3O and a molecular weight of 373.64 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentyl]-3-chlorobenzene.
| Compound Name | 1-[2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentyl]-3-chlorobenzene |
|---|---|
| PubChem CID | 66043122 |
| Molecular Formula | C14H17BrClF3O |
| Molecular Weight | 373.64 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 1-[2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentyl]-3-chlorobenzene |
| SMILES | FC(F)(F)COCCCC(CBr)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H17BrClF3O/c15-9-12(4-2-6-20-10-14(17,18)19)7-11-3-1-5-13(16)8-11/h1,3,5,8,12H,2,4,6-7,9-10H2 |
| InChIKey | WBCMKLSXNTYGMD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|